C28H35NO4 — CID 11351401
(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-N-prop-2-enylbut-3-en-1-amine (PubChem CID 11351401) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-N-prop-2-enylbut-3-en-1-amine.
| Compound Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-N-prop-2-enylbut-3-en-1-amine |
|---|---|
| PubChem CID | 11351401 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-N-benzyl-N-prop-2-enylbut-3-en-1-amine |
| SMILES | C=CC[C@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)N(CC=C)Cc1ccccc1 |
| InChI | InChI=1S/C28H35NO4/c1-5-13-23(29(18-6-2)19-21-14-9-7-10-15-21)24-25(30-20-22-16-11-8-12-17-22)26-27(31-24)33-28(3,4)32-26/h5-12,14-17,23-27H,1-2,13,18-20H2,3-4H3/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | VTRBNEQQXRVKQF-IURCNINISA-N |
| XLogP | 5.08 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|