C19H29O12PS — CID 11352770
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 11352770) has the molecular formula C19H29O12PS and a molecular weight of 512.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11352770 |
| Molecular Formula | C19H29O12PS |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SP2(=O)OCC(C)(C)CO2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H29O12PS/c1-10(20)25-7-14-15(28-11(2)21)16(29-12(3)22)17(30-13(4)23)18(31-14)33-32(24)26-8-19(5,6)9-27-32/h14-18H,7-9H2,1-6H3/t14-,15+,16+,17-,18+/m1/s1 |
| InChIKey | SUWGOSBFJRXGKM-ICUGJSFKSA-N |
| XLogP | 1.98 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|