C29H40O5SSi — CID 11353047
2-[(1R,3R,4R,7R,9R,11S)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-2,10-dioxa-5-thiatricyclo[7.3.0.03,7]dodecan-4-yl]ethanol (PubChem CID 11353047) has the molecular formula C29H40O5SSi and a molecular weight of 528.79 g/mol. Its IUPAC name is 2-[(1R,3R,4R,7R,9R,11S)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-2,10-dioxa-5-thiatricyclo[7.3.0.03,7]dodecan-4-yl]ethanol.
| Compound Name | 2-[(1R,3R,4R,7R,9R,11S)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-2,10-dioxa-5-thiatricyclo[7.3.0.03,7]dodecan-4-yl]ethanol |
|---|---|
| PubChem CID | 11353047 |
| Molecular Formula | C29H40O5SSi |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[(1R,3R,4R,7R,9R,11S)-11-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxy-2,10-dioxa-5-thiatricyclo[7.3.0.03,7]dodecan-4-yl]ethanol |
| SMILES | CO[C@@]12O[C@@H]3C[C@@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)O[C@@H]3C[C@H]1CS[C@@H]2CCO |
| InChI | InChI=1S/C29H40O5SSi/c1-28(2,3)36(23-11-7-5-8-12-23,24-13-9-6-10-14-24)32-19-22-18-26-25(33-22)17-21-20-35-27(15-16-30)29(21,31-4)34-26/h5-14,21-22,25-27,30H,15-20H2,1-4H3/t21-,22-,25+,26+,27+,29+/m0/s1 |
| InChIKey | VCXRRJOAQKCSDD-YLUKURSSSA-N |
| XLogP | 3.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|