C31H42N2O7 — CID 11353423
[(3aR,5R,6R,7R,7aS)-5-(hydroxymethyl)-2-[(phenylcarbamoylamino)methyl]-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] octanoate (PubChem CID 11353423) has the molecular formula C31H42N2O7 and a molecular weight of 554.68 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aS)-5-(hydroxymethyl)-2-[(phenylcarbamoylamino)methyl]-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] octanoate.
| Compound Name | [(3aR,5R,6R,7R,7aS)-5-(hydroxymethyl)-2-[(phenylcarbamoylamino)methyl]-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] octanoate |
|---|---|
| PubChem CID | 11353423 |
| Molecular Formula | C31H42N2O7 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | [(3aR,5R,6R,7R,7aS)-5-(hydroxymethyl)-2-[(phenylcarbamoylamino)methyl]-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@H]2OC(CNC(=O)Nc3ccccc3)C[C@H]2O[C@@H]1CO |
| InChI | InChI=1S/C31H42N2O7/c1-2-3-4-5-12-17-27(35)40-29-26(20-34)39-25-18-24(19-32-31(36)33-23-15-10-7-11-16-23)38-28(25)30(29)37-21-22-13-8-6-9-14-22/h6-11,13-16,24-26,28-30,34H,2-5,12,17-21H2,1H3,(H2,32,33,36)/t24?,25-,26-,28+,29-,30-/m1/s1 |
| InChIKey | DLYOODHRJGTWBK-CCVXBZRGSA-N |
| XLogP | 4.58 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|