C32H37NO6 — CID 72749080
[2-[(benzylamino)methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate (PubChem CID 72749080) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is [2-[(benzylamino)methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate.
| Compound Name | [2-[(benzylamino)methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 72749080 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | [2-[(benzylamino)methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC1C(CO)OC2CC(CNCc3ccccc3)OC2C1OCc1ccccc1 |
| InChI | InChI=1S/C32H37NO6/c34-21-28-31(39-29(35)17-16-23-10-4-1-5-11-23)32(36-22-25-14-8-3-9-15-25)30-27(38-28)18-26(37-30)20-33-19-24-12-6-2-7-13-24/h1-15,26-28,30-34H,16-22H2 |
| InChIKey | BAFSEWPQWVDGNX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |