C29H32N2O6 — CID 156566892
4-(hydroxyamino)-N-[[(2S,5R,6R)-6-phenylmethoxy-5-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methyl]benzamide (PubChem CID 156566892) has the molecular formula C29H32N2O6 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-(hydroxyamino)-N-[[(2S,5R,6R)-6-phenylmethoxy-5-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methyl]benzamide.
| Compound Name | 4-(hydroxyamino)-N-[[(2S,5R,6R)-6-phenylmethoxy-5-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 156566892 |
| Molecular Formula | C29H32N2O6 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 4-(hydroxyamino)-N-[[(2S,5R,6R)-6-phenylmethoxy-5-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CC2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C2O1)c1ccc(NO)cc1 |
| InChI | InChI=1S/C29H32N2O6/c32-29(22-11-13-23(31-33)14-12-22)30-16-24-15-25-28(36-24)27(35-18-21-9-5-2-6-10-21)26(37-25)19-34-17-20-7-3-1-4-8-20/h1-14,24-28,31,33H,15-19H2,(H,30,32)/t24-,25?,26+,27+,28?/m0/s1 |
| InChIKey | KQPFHRFIADXWQE-ZIDKEBONSA-N |
| XLogP | 3.94 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|