C40H51NO7 — CID 11354309
[(3aR,5R,6R,7R,7aS)-2-[[benzyl(octanoyl)amino]methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate (PubChem CID 11354309) has the molecular formula C40H51NO7 and a molecular weight of 657.85 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aS)-2-[[benzyl(octanoyl)amino]methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate.
| Compound Name | [(3aR,5R,6R,7R,7aS)-2-[[benzyl(octanoyl)amino]methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 11354309 |
| Molecular Formula | C40H51NO7 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.37 |
| IUPAC Name | [(3aR,5R,6R,7R,7aS)-2-[[benzyl(octanoyl)amino]methyl]-5-(hydroxymethyl)-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6-yl] 3-phenylpropanoate |
| SMILES | CCCCCCCC(=O)N(Cc1ccccc1)CC1C[C@H]2O[C@H](CO)[C@@H](OC(=O)CCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C40H51NO7/c1-2-3-4-5-15-22-36(43)41(26-31-18-11-7-12-19-31)27-33-25-34-38(46-33)40(45-29-32-20-13-8-14-21-32)39(35(28-42)47-34)48-37(44)24-23-30-16-9-6-10-17-30/h6-14,16-21,33-35,38-40,42H,2-5,15,22-29H2,1H3/t33?,34-,35-,38+,39-,40-/m1/s1 |
| InChIKey | UBEYXHOATZDXNS-GYNFDLANSA-N |
| XLogP | 6.42 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|