C34H40O9 — CID 11353822
(1S,2S,4S,6'R,9R,11S)-9-methoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone (PubChem CID 11353822) has the molecular formula C34H40O9 and a molecular weight of 592.69 g/mol. Its IUPAC name is (1S,2S,4S,6'R,9R,11S)-9-methoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone.
| Compound Name | (1S,2S,4S,6'R,9R,11S)-9-methoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone |
|---|---|
| PubChem CID | 11353822 |
| Molecular Formula | C34H40O9 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | (1S,2S,4S,6'R,9R,11S)-9-methoxy-2',2',13,13-tetramethyl-6',11-bis(3-methylbut-2-enyl)spiro[3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-ene-4,7'-6H-chromene]-5',6,8',10-tetrone |
| SMILES | CO[C@@]12C=C3C(=O)O[C@]4(O[C@@]35[C@@H](C1)C(C)(C)O[C@]5(CC=C(C)C)C2=O)C(=O)C1=C(C=CC(C)(C)O1)C(=O)[C@H]4CC=C(C)C |
| InChI | InChI=1S/C34H40O9/c1-18(2)10-11-21-24(35)20-13-14-29(5,6)40-25(20)26(36)34(21)41-27(37)22-16-31(39-9)17-23-30(7,8)42-32(28(31)38,15-12-19(3)4)33(22,23)43-34/h10,12-14,16,21,23H,11,15,17H2,1-9H3/t21-,23+,31+,32-,33-,34-/m1/s1 |
| InChIKey | HPXYRFJVBIOJKL-YDPZXRSCSA-N |
| XLogP | 4.56 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|