C21H30O5 — CID 11382893
(1S,2S,9R,11S)-9-methoxy-4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-10-one (PubChem CID 11382893) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,2S,9R,11S)-9-methoxy-4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-10-one.
| Compound Name | (1S,2S,9R,11S)-9-methoxy-4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-10-one |
|---|---|
| PubChem CID | 11382893 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,2S,9R,11S)-9-methoxy-4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-10-one |
| SMILES | CO[C@@]12C=C3COC(C)(C)O[C@@]34[C@@H](C1)C(C)(C)O[C@]4(CC=C(C)C)C2=O |
| InChI | InChI=1S/C21H30O5/c1-13(2)8-9-20-16(22)19(23-7)10-14-12-24-18(5,6)26-21(14,20)15(11-19)17(3,4)25-20/h8,10,15H,9,11-12H2,1-7H3/t15-,19-,20+,21+/m0/s1 |
| InChIKey | INIBOVJJPUEHFH-JWOSDPRPSA-N |
| XLogP | 3.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|