C20H24O5 — CID 102303092
(1S,2S,9R)-9-methoxy-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-5,7-diene-4,10-dione (PubChem CID 102303092) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,2S,9R)-9-methoxy-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-5,7-diene-4,10-dione.
| Compound Name | (1S,2S,9R)-9-methoxy-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-5,7-diene-4,10-dione |
|---|---|
| PubChem CID | 102303092 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1S,2S,9R)-9-methoxy-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-5,7-diene-4,10-dione |
| SMILES | CO[C@@]12C=C3C=CC(=O)O[C@@]34[C@@H](C1)C(C)(C)OC4(CC=C(C)C)C2=O |
| InChI | InChI=1S/C20H24O5/c1-12(2)8-9-19-16(22)18(23-5)10-13-6-7-15(21)24-20(13,19)14(11-18)17(3,4)25-19/h6-8,10,14H,9,11H2,1-5H3/t14-,18-,19?,20+/m0/s1 |
| InChIKey | RKMSOAKDOCMMBK-ZQFFQFRGSA-N |
| XLogP | 2.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|