C20H24O5 — CID 102303091
(1R,6R,11S)-8-methoxy-4,4-dimethyl-6-(3-methylbut-2-enyl)-5,12-dioxatetracyclo[8.3.1.03,11.06,11]tetradeca-8,10(14)-diene-7,13-dione (PubChem CID 102303091) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1R,6R,11S)-8-methoxy-4,4-dimethyl-6-(3-methylbut-2-enyl)-5,12-dioxatetracyclo[8.3.1.03,11.06,11]tetradeca-8,10(14)-diene-7,13-dione.
| Compound Name | (1R,6R,11S)-8-methoxy-4,4-dimethyl-6-(3-methylbut-2-enyl)-5,12-dioxatetracyclo[8.3.1.03,11.06,11]tetradeca-8,10(14)-diene-7,13-dione |
|---|---|
| PubChem CID | 102303091 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,6R,11S)-8-methoxy-4,4-dimethyl-6-(3-methylbut-2-enyl)-5,12-dioxatetracyclo[8.3.1.03,11.06,11]tetradeca-8,10(14)-diene-7,13-dione |
| SMILES | COC1=CC2=C[C@H]3CC4C(C)(C)O[C@@](CC=C(C)C)(C1=O)[C@@]24OC3=O |
| InChI | InChI=1S/C20H24O5/c1-11(2)6-7-19-16(21)14(23-5)10-13-8-12-9-15(18(3,4)25-19)20(13,19)24-17(12)22/h6,8,10,12,15H,7,9H2,1-5H3/t12-,15?,19-,20+/m0/s1 |
| InChIKey | MOUMTMGXKQXSLV-GCHAJIPLSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|