C30H34O5 — CID 57395741
(1S,2S,9S,11R)-4-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-4,7-diene-6,10-dione (PubChem CID 57395741) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is (1S,2S,9S,11R)-4-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-4,7-diene-6,10-dione.
| Compound Name | (1S,2S,9S,11R)-4-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-4,7-diene-6,10-dione |
|---|---|
| PubChem CID | 57395741 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (1S,2S,9S,11R)-4-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]-13,13-dimethyl-11-(3-methylbut-2-enyl)-3,12-dioxatetracyclo[7.4.1.02,7.02,11]tetradeca-4,7-diene-6,10-dione |
| SMILES | CC(C)=CCc1cc(C2=CC(=O)C3=C[C@@H]4C[C@H]5C(C)(C)O[C@@](CC=C(C)C)(C4=O)[C@@]35O2)ccc1O |
| InChI | InChI=1S/C30H34O5/c1-17(2)7-8-19-13-20(9-10-23(19)31)25-16-24(32)22-14-21-15-26-28(5,6)35-29(27(21)33,12-11-18(3)4)30(22,26)34-25/h7,9-11,13-14,16,21,26,31H,8,12,15H2,1-6H3/t21-,26+,29+,30-/m1/s1 |
| InChIKey | DPCFFOBSDPKXEL-TTYMUKSTSA-N |
| XLogP | 5.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|