C28H32O6 — CID 44583731
(1S,2S,13S,15R)-6,8-dihydroxy-17,17-dimethyl-5-(2-methylbut-3-en-2-yl)-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione (PubChem CID 44583731) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (1S,2S,13S,15R)-6,8-dihydroxy-17,17-dimethyl-5-(2-methylbut-3-en-2-yl)-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione.
| Compound Name | (1S,2S,13S,15R)-6,8-dihydroxy-17,17-dimethyl-5-(2-methylbut-3-en-2-yl)-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 44583731 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (1S,2S,13S,15R)-6,8-dihydroxy-17,17-dimethyl-5-(2-methylbut-3-en-2-yl)-15-(3-methylbut-2-enyl)-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4(9),5,7,11-tetraene-10,14-dione |
| SMILES | C=CC(C)(C)c1c(O)cc(O)c2c1O[C@]13C(=C[C@@H]4C[C@H]1C(C)(C)O[C@@]3(CC=C(C)C)C4=O)C2=O |
| InChI | InChI=1S/C28H32O6/c1-8-25(4,5)21-18(30)13-17(29)20-22(31)16-11-15-12-19-26(6,7)34-27(24(15)32,10-9-14(2)3)28(16,19)33-23(20)21/h8-9,11,13,15,19,29-30H,1,10,12H2,2-7H3/t15-,19+,27+,28-/m1/s1 |
| InChIKey | IQYGGNGWJAGSBX-XNTJLPCESA-N |
| XLogP | 4.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|