C28H30O6 — CID 71716450
(1S,2S,17S)-12-hydroxy-8,8,21,21-tetramethyl-19-(3-methylbut-2-enyl)-3,9,20-trioxahexacyclo[15.4.1.02,15.02,19.04,13.05,10]docosa-4(13),5(10),6,11,15-pentaene-14,18-dione (PubChem CID 71716450) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is (1S,2S,17S)-12-hydroxy-8,8,21,21-tetramethyl-19-(3-methylbut-2-enyl)-3,9,20-trioxahexacyclo[15.4.1.02,15.02,19.04,13.05,10]docosa-4(13),5(10),6,11,15-pentaene-14,18-dione.
| Compound Name | (1S,2S,17S)-12-hydroxy-8,8,21,21-tetramethyl-19-(3-methylbut-2-enyl)-3,9,20-trioxahexacyclo[15.4.1.02,15.02,19.04,13.05,10]docosa-4(13),5(10),6,11,15-pentaene-14,18-dione |
|---|---|
| PubChem CID | 71716450 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (1S,2S,17S)-12-hydroxy-8,8,21,21-tetramethyl-19-(3-methylbut-2-enyl)-3,9,20-trioxahexacyclo[15.4.1.02,15.02,19.04,13.05,10]docosa-4(13),5(10),6,11,15-pentaene-14,18-dione |
| SMILES | CC(C)=CCC12OC(C)(C)[C@@H]3C[C@@H](C=C4C(=O)c5c(O)cc6c(c5O[C@]431)C=CC(C)(C)O6)C2=O |
| InChI | InChI=1S/C28H30O6/c1-14(2)7-10-27-24(31)15-11-17-22(30)21-18(29)13-19-16(8-9-25(3,4)32-19)23(21)33-28(17,27)20(12-15)26(5,6)34-27/h7-9,11,13,15,20,29H,10,12H2,1-6H3/t15-,20+,27?,28-/m1/s1 |
| InChIKey | YRQDRRMNQYXEQF-TYTBCFIUSA-N |
| XLogP | 4.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|