C34H40O9 — CID 11387761
(1R,3S,6S,7S)-7-[2,2-dimethyl-6-(3-methylbut-2-enyl)-5,8-dioxochromen-7-yl]oxy-1-methoxy-5,5-dimethyl-3-(3-methylbut-2-enyl)-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylic acid (PubChem CID 11387761) has the molecular formula C34H40O9 and a molecular weight of 592.69 g/mol. Its IUPAC name is (1R,3S,6S,7S)-7-[2,2-dimethyl-6-(3-methylbut-2-enyl)-5,8-dioxochromen-7-yl]oxy-1-methoxy-5,5-dimethyl-3-(3-methylbut-2-enyl)-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylic acid.
| Compound Name | (1R,3S,6S,7S)-7-[2,2-dimethyl-6-(3-methylbut-2-enyl)-5,8-dioxochromen-7-yl]oxy-1-methoxy-5,5-dimethyl-3-(3-methylbut-2-enyl)-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 11387761 |
| Molecular Formula | C34H40O9 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | (1R,3S,6S,7S)-7-[2,2-dimethyl-6-(3-methylbut-2-enyl)-5,8-dioxochromen-7-yl]oxy-1-methoxy-5,5-dimethyl-3-(3-methylbut-2-enyl)-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-8-carboxylic acid |
| SMILES | CO[C@@]12C=C(C(=O)O)[C@@]3(OC4=C(CC=C(C)C)C(=O)C5=C(OC(C)(C)C=C5)C4=O)[C@@H](C1)C(C)(C)O[C@]3(CC=C(C)C)C2=O |
| InChI | InChI=1S/C34H40O9/c1-18(2)10-11-20-24(35)21-13-14-30(5,6)41-26(21)25(36)27(20)42-34-22(28(37)38)16-32(40-9)17-23(34)31(7,8)43-33(34,29(32)39)15-12-19(3)4/h10,12-14,16,23H,11,15,17H2,1-9H3,(H,37,38)/t23-,32-,33+,34+/m0/s1 |
| InChIKey | XNRBLHYVGFIRHO-FTFOQTBQSA-N |
| XLogP | 5.03 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|