C42H52N2O14 — CID 11354815
bis(tert-butyl-[(2S)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]azanium);(2S,3S)-2,3-dibenzoyloxybutanedioate (PubChem CID 11354815) has the molecular formula C42H52N2O14 and a molecular weight of 808.88 g/mol. Its IUPAC name is bis(tert-butyl-[(2S)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]azanium);(2S,3S)-2,3-dibenzoyloxybutanedioate.
| Compound Name | bis(tert-butyl-[(2S)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]azanium);(2S,3S)-2,3-dibenzoyloxybutanedioate |
|---|---|
| PubChem CID | 11354815 |
| Molecular Formula | C42H52N2O14 |
| Molecular Weight | 808.88 g/mol |
| Exact Mass | 808.34 |
| IUPAC Name | bis(tert-butyl-[(2S)-2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]azanium);(2S,3S)-2,3-dibenzoyloxybutanedioate |
| SMILES | CC(C)(C)[NH2+]C[C@@H](O)c1cc(O)cc(O)c1.CC(C)(C)[NH2+]C[C@@H](O)c1cc(O)cc(O)c1.O=C(O[C@H](C(=O)[O-])[C@H](OC(=O)c1ccccc1)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H14O8.2C12H19NO3/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12;2*1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h1-10,13-14H,(H,19,20)(H,21,22);2*4-6,11,13-16H,7H2,1-3H3/t13-,14-;2*11-/m011/s1 |
| InChIKey | AYDOKEGWUILWEV-UMVIJWALSA-N |
| XLogP | -0.08 |
| TPSA | 287.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.88 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |