C28H26ClNO8 — CID 7168854
(2S,3S)-2,3-dibenzoyloxy-4-[(2S)-1-(benzylazaniumyl)-3-chloropropan-2-yl]oxy-4-oxobutanoate (PubChem CID 7168854) has the molecular formula C28H26ClNO8 and a molecular weight of 539.97 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzoyloxy-4-[(2S)-1-(benzylazaniumyl)-3-chloropropan-2-yl]oxy-4-oxobutanoate.
| Compound Name | (2S,3S)-2,3-dibenzoyloxy-4-[(2S)-1-(benzylazaniumyl)-3-chloropropan-2-yl]oxy-4-oxobutanoate |
|---|---|
| PubChem CID | 7168854 |
| Molecular Formula | C28H26ClNO8 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | (2S,3S)-2,3-dibenzoyloxy-4-[(2S)-1-(benzylazaniumyl)-3-chloropropan-2-yl]oxy-4-oxobutanoate |
| SMILES | O=C(O[C@H](C(=O)[O-])[C@H](OC(=O)c1ccccc1)C(=O)O[C@H](CCl)C[NH2+]Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26ClNO8/c29-16-22(18-30-17-19-10-4-1-5-11-19)36-28(35)24(38-27(34)21-14-8-3-9-15-21)23(25(31)32)37-26(33)20-12-6-2-7-13-20/h1-15,22-24,30H,16-18H2,(H,31,32)/t22-,23+,24+/m1/s1 |
| InChIKey | ZUAJUCVCIVWSBY-SGNDLWITSA-N |
| XLogP | 1.10 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|