C7H6F6N2OS — CID 11357953
2-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11357953) has the molecular formula C7H6F6N2OS and a molecular weight of 280.19 g/mol. Its IUPAC name is 2-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11357953 |
| Molecular Formula | C7H6F6N2OS |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1nc(N)sc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6N2OS/c1-2-3(17-4(14)15-2)5(16,6(8,9)10)7(11,12)13/h16H,1H3,(H2,14,15) |
| InChIKey | AHBIYGBFBJYWPE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |