C7H5F7N2S — CID 123627610
5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 123627610) has the molecular formula C7H5F7N2S and a molecular weight of 282.18 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 123627610 |
| Molecular Formula | C7H5F7N2S |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7N2S/c1-2-3(17-4(15)16-2)5(8,6(9,10)11)7(12,13)14/h1H3,(H2,15,16) |
| InChIKey | IUWVFEIICXLRBS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |