C7H10N2S — CID 64919436
4-cyclopropyl-5-methyl-1,3-thiazol-2-amine (PubChem CID 64919436) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 4-cyclopropyl-5-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-cyclopropyl-5-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 64919436 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 4-cyclopropyl-5-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1sc(N)nc1C1CC1 |
| InChI | InChI=1S/C7H10N2S/c1-4-6(5-2-3-5)9-7(8)10-4/h5H,2-3H2,1H3,(H2,8,9) |
| InChIKey | XOKZIZHJSZSXFK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |