C18H15N5 — CID 11358523
(4-ethylpyrimido[1,2-a]benzimidazol-3-yl)-phenyldiazene (PubChem CID 11358523) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is (4-ethylpyrimido[1,2-a]benzimidazol-3-yl)-phenyldiazene.
| Compound Name | (4-ethylpyrimido[1,2-a]benzimidazol-3-yl)-phenyldiazene |
|---|---|
| PubChem CID | 11358523 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (4-ethylpyrimido[1,2-a]benzimidazol-3-yl)-phenyldiazene |
| SMILES | CCc1c(/N=N/c2ccccc2)cnc2nc3ccccc3n12 |
| InChI | InChI=1S/C18H15N5/c1-2-16-15(22-21-13-8-4-3-5-9-13)12-19-18-20-14-10-6-7-11-17(14)23(16)18/h3-12H,2H2,1H3/b22-21+ |
| InChIKey | PYDAZKYUINXOIF-QURGRASLSA-N |
| XLogP | 4.86 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|