C22H15N3O2 — CID 136824529
4-(3-phenylpyrimido[1,2-a]benzimidazol-4-yl)benzene-1,3-diol (PubChem CID 136824529) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-(3-phenylpyrimido[1,2-a]benzimidazol-4-yl)benzene-1,3-diol.
| Compound Name | 4-(3-phenylpyrimido[1,2-a]benzimidazol-4-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136824529 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-(3-phenylpyrimido[1,2-a]benzimidazol-4-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(-c2c(-c3ccccc3)cnc3nc4ccccc4n23)c(O)c1 |
| InChI | InChI=1S/C22H15N3O2/c26-15-10-11-16(20(27)12-15)21-17(14-6-2-1-3-7-14)13-23-22-24-18-8-4-5-9-19(18)25(21)22/h1-13,26-27H |
| InChIKey | SCBYZPLFIKGGAK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |