C15H32OS2Si — CID 11359125
2-(1,3-dithian-2-yl)ethoxy-tri(propan-2-yl)silane (PubChem CID 11359125) has the molecular formula C15H32OS2Si and a molecular weight of 320.64 g/mol. Its IUPAC name is 2-(1,3-dithian-2-yl)ethoxy-tri(propan-2-yl)silane.
| Compound Name | 2-(1,3-dithian-2-yl)ethoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11359125 |
| Molecular Formula | C15H32OS2Si |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-(1,3-dithian-2-yl)ethoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCCC1SCCCS1)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H32OS2Si/c1-12(2)19(13(3)4,14(5)6)16-9-8-15-17-10-7-11-18-15/h12-15H,7-11H2,1-6H3 |
| InChIKey | BIGBWPRJCAXHEB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|