C20H22N4O — CID 11359568
N,2,3-trimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-6-carboxamide (PubChem CID 11359568) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N,2,3-trimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-6-carboxamide.
| Compound Name | N,2,3-trimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 11359568 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N,2,3-trimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridine-6-carboxamide |
| SMILES | CNC(=O)c1cn2c(C)c(C)nc2c2c1CCC(c1ccccc1)N2 |
| InChI | InChI=1S/C20H22N4O/c1-12-13(2)24-11-16(20(25)21-3)15-9-10-17(14-7-5-4-6-8-14)23-18(15)19(24)22-12/h4-8,11,17,23H,9-10H2,1-3H3,(H,21,25) |
| InChIKey | MHQAZNAOHAUPHL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |