C24H30N4O3 — CID 10224068
[(7S,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] N,N-diethylcarbamate (PubChem CID 10224068) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is [(7S,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] N,N-diethylcarbamate.
| Compound Name | [(7S,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 10224068 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(7S,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[C@@H]1[C@@H](c2ccccc2)Nc2c(ccn3c(C)c(C)nc23)[C@@H]1OC |
| InChI | InChI=1S/C24H30N4O3/c1-6-27(7-2)24(29)31-22-19(17-11-9-8-10-12-17)26-20-18(21(22)30-5)13-14-28-16(4)15(3)25-23(20)28/h8-14,19,21-22,26H,6-7H2,1-5H3/t19-,21+,22-/m1/s1 |
| InChIKey | XLVHSMUCKCXRRQ-BAGYTPMASA-N |
| XLogP | 4.65 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |