C19H18F3N3O2 — CID 139935408
(7R,8R,9R)-2,3-dimethyl-9-phenyl-7-(trifluoromethoxy)-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol (PubChem CID 139935408) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is (7R,8R,9R)-2,3-dimethyl-9-phenyl-7-(trifluoromethoxy)-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol.
| Compound Name | (7R,8R,9R)-2,3-dimethyl-9-phenyl-7-(trifluoromethoxy)-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol |
|---|---|
| PubChem CID | 139935408 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (7R,8R,9R)-2,3-dimethyl-9-phenyl-7-(trifluoromethoxy)-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol |
| SMILES | Cc1nc2c3c(ccn2c1C)[C@@H](OC(F)(F)F)[C@H](O)[C@@H](c1ccccc1)N3 |
| InChI | InChI=1S/C19H18F3N3O2/c1-10-11(2)25-9-8-13-15(18(25)23-10)24-14(12-6-4-3-5-7-12)16(26)17(13)27-19(20,21)22/h3-9,14,16-17,24,26H,1-2H3/t14-,16-,17-/m1/s1 |
| InChIKey | ZVWCFYQIYPGRFZ-DJIMGWMZSA-N |
| XLogP | 4.06 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |