C21H23N3O4 — CID 10193995
[(7R,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] methyl carbonate (PubChem CID 10193995) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(7R,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] methyl carbonate.
| Compound Name | [(7R,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] methyl carbonate |
|---|---|
| PubChem CID | 10193995 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [(7R,8R,9R)-7-methoxy-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1[C@@H](c2ccccc2)Nc2c(ccn3c(C)c(C)nc23)[C@H]1OC |
| InChI | InChI=1S/C21H23N3O4/c1-12-13(2)24-11-10-15-17(20(24)22-12)23-16(14-8-6-5-7-9-14)19(18(15)26-3)28-21(25)27-4/h5-11,16,18-19,23H,1-4H3/t16-,18-,19-/m1/s1 |
| InChIKey | PQYOFNTUPBMMJT-BHIYHBOVSA-N |
| XLogP | 3.96 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |