C28H35N3O5 — CID 87757200
[10-acetyl-2,3-dimethyl-9-phenyl-7-(1,1,2,2-tetradeuterio-2-methoxyethoxy)-8,9-dihydro-7H-imidazo[1,2-h][1,7]naphthyridin-8-yl] 2,2-dimethylpropanoate (PubChem CID 87757200) has the molecular formula C28H35N3O5 and a molecular weight of 497.63 g/mol. Its IUPAC name is [10-acetyl-2,3-dimethyl-9-phenyl-7-(1,1,2,2-tetradeuterio-2-methoxyethoxy)-8,9-dihydro-7H-imidazo[1,2-h][1,7]naphthyridin-8-yl] 2,2-dimethylpropanoate.
| Compound Name | [10-acetyl-2,3-dimethyl-9-phenyl-7-(1,1,2,2-tetradeuterio-2-methoxyethoxy)-8,9-dihydro-7H-imidazo[1,2-h][1,7]naphthyridin-8-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87757200 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | [10-acetyl-2,3-dimethyl-9-phenyl-7-(1,1,2,2-tetradeuterio-2-methoxyethoxy)-8,9-dihydro-7H-imidazo[1,2-h][1,7]naphthyridin-8-yl] 2,2-dimethylpropanoate |
| SMILES | [2H]C([2H])(OC)C([2H])([2H])OC1c2ccn3c(C)c(C)nc3c2N(C(C)=O)C(c2ccccc2)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H35N3O5/c1-17-18(2)30-14-13-21-23(26(30)29-17)31(19(3)32)22(20-11-9-8-10-12-20)25(24(21)35-16-15-34-7)36-27(33)28(4,5)6/h8-14,22,24-25H,15-16H2,1-7H3/i15D2,16D2 |
| InChIKey | DIHUBPBLCYJYKO-ONNKGWAKSA-N |
| XLogP | 4.72 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |