C20H23N3OS — CID 10150129
(7S,8R,9R)-7-ethylsulfanyl-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol (PubChem CID 10150129) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is (7S,8R,9R)-7-ethylsulfanyl-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol.
| Compound Name | (7S,8R,9R)-7-ethylsulfanyl-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol |
|---|---|
| PubChem CID | 10150129 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (7S,8R,9R)-7-ethylsulfanyl-2,3-dimethyl-9-phenyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-8-ol |
| SMILES | CCS[C@H]1c2ccn3c(C)c(C)nc3c2N[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C20H23N3OS/c1-4-25-19-15-10-11-23-13(3)12(2)21-20(23)17(15)22-16(18(19)24)14-8-6-5-7-9-14/h5-11,16,18-19,22,24H,4H2,1-3H3/t16-,18-,19+/m1/s1 |
| InChIKey | ZIDBAWWZFPJMOA-QRQLOZEOSA-N |
| XLogP | 4.27 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |