C18H17Cl2N3O — CID 143012831
9-(2,4-dichlorophenyl)-2,3-dimethyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-7-ol (PubChem CID 143012831) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is 9-(2,4-dichlorophenyl)-2,3-dimethyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-7-ol.
| Compound Name | 9-(2,4-dichlorophenyl)-2,3-dimethyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-7-ol |
|---|---|
| PubChem CID | 143012831 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 9-(2,4-dichlorophenyl)-2,3-dimethyl-7,8,9,10-tetrahydroimidazo[1,2-h][1,7]naphthyridin-7-ol |
| SMILES | Cc1nc2c3c(ccn2c1C)C(O)CC(c1ccc(Cl)cc1Cl)N3 |
| InChI | InChI=1S/C18H17Cl2N3O/c1-9-10(2)23-6-5-13-16(24)8-15(22-17(13)18(23)21-9)12-4-3-11(19)7-14(12)20/h3-7,15-16,22,24H,8H2,1-2H3 |
| InChIKey | YFWQJNLVFYXKGV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |