C21H23N3OS — CID 87834010
(12S)-N,N,4,5-tetramethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbothioamide (PubChem CID 87834010) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is (12S)-N,N,4,5-tetramethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbothioamide.
| Compound Name | (12S)-N,N,4,5-tetramethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbothioamide |
|---|---|
| PubChem CID | 87834010 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (12S)-N,N,4,5-tetramethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbothioamide |
| SMILES | Cc1nc2c3c(c(C(=S)N(C)C)cn2c1C)CC[C@@H](c1ccccc1)O3 |
| InChI | InChI=1S/C21H23N3OS/c1-13-14(2)24-12-17(21(26)23(3)4)16-10-11-18(15-8-6-5-7-9-15)25-19(16)20(24)22-13/h5-9,12,18H,10-11H2,1-4H3/t18-/m0/s1 |
| InChIKey | XPXSIXBHPJCEPV-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|