C21H22N2O3 — CID 69437247
7-ethyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxylic acid (PubChem CID 69437247) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 7-ethyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxylic acid.
| Compound Name | 7-ethyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxylic acid |
|---|---|
| PubChem CID | 69437247 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 7-ethyl-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c2c(c3nc(C)c(C)n13)OC(c1ccccc1)CC2 |
| InChI | InChI=1S/C21H22N2O3/c1-4-16-18(21(24)25)15-10-11-17(14-8-6-5-7-9-14)26-19(15)20-22-12(2)13(3)23(16)20/h5-9,17H,4,10-11H2,1-3H3,(H,24,25) |
| InChIKey | ZFDBJHXRBNQYNA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |