C24H28N4O3 — CID 12003070
N-(2,3-dihydroxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,9'-8,10-dihydro-7H-imidazo[1,2-h][1,7]naphthyridine]-6'-carboxamide (PubChem CID 12003070) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,9'-8,10-dihydro-7H-imidazo[1,2-h][1,7]naphthyridine]-6'-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,9'-8,10-dihydro-7H-imidazo[1,2-h][1,7]naphthyridine]-6'-carboxamide |
|---|---|
| PubChem CID | 12003070 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2',3'-dimethylspiro[1,3-dihydroindene-2,9'-8,10-dihydro-7H-imidazo[1,2-h][1,7]naphthyridine]-6'-carboxamide |
| SMILES | Cc1nc2c3c(c(C(=O)NCC(O)CO)cn2c1C)CCC1(Cc2ccccc2C1)N3 |
| InChI | InChI=1S/C24H28N4O3/c1-14-15(2)28-12-20(23(31)25-11-18(30)13-29)19-7-8-24(27-21(19)22(28)26-14)9-16-5-3-4-6-17(16)10-24/h3-6,12,18,27,29-30H,7-11,13H2,1-2H3,(H,25,31) |
| InChIKey | FGSYOAXAZOWLRR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |