C21H29NO3S2 — CID 11361813
O-methyl [(8aS,12R,12aS)-2,3-dimethoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-b]isoquinolin-12-yl]sulfanylmethanethioate (PubChem CID 11361813) has the molecular formula C21H29NO3S2 and a molecular weight of 407.60 g/mol. Its IUPAC name is O-methyl [(8aS,12R,12aS)-2,3-dimethoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-b]isoquinolin-12-yl]sulfanylmethanethioate.
| Compound Name | O-methyl [(8aS,12R,12aS)-2,3-dimethoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-b]isoquinolin-12-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11361813 |
| Molecular Formula | C21H29NO3S2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | O-methyl [(8aS,12R,12aS)-2,3-dimethoxy-6,8,8a,9,10,11,12,12a,13,13a-decahydro-5H-isoquinolino[2,1-b]isoquinolin-12-yl]sulfanylmethanethioate |
| SMILES | COC(=S)S[C@@H]1CCC[C@@H]2CN3CCc4cc(OC)c(OC)cc4C3C[C@@H]21 |
| InChI | InChI=1S/C21H29NO3S2/c1-23-18-9-13-7-8-22-12-14-5-4-6-20(27-21(26)25-3)16(14)10-17(22)15(13)11-19(18)24-2/h9,11,14,16-17,20H,4-8,10,12H2,1-3H3/t14-,16+,17?,20-/m1/s1 |
| InChIKey | NFEHTLJVTXDHSC-SVMMFVHSSA-N |
| XLogP | 4.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|