C10H4F9NO5S — CID 11362175
(2-nitrophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11362175) has the molecular formula C10H4F9NO5S and a molecular weight of 421.19 g/mol. Its IUPAC name is (2-nitrophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (2-nitrophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11362175 |
| Molecular Formula | C10H4F9NO5S |
| Molecular Weight | 421.19 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | (2-nitrophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=[N+]([O-])c1ccccc1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F9NO5S/c11-7(12,9(15,16)17)8(13,14)10(18,19)26(23,24)25-6-4-2-1-3-5(6)20(21)22/h1-4H |
| InChIKey | LKLVLEFJUVYGBD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|