C24H42O4Si — CID 11362234
[(E,2R)-2-(methoxymethoxy)-2-methyl-5-phenylmethoxypent-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 11362234) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is [(E,2R)-2-(methoxymethoxy)-2-methyl-5-phenylmethoxypent-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E,2R)-2-(methoxymethoxy)-2-methyl-5-phenylmethoxypent-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11362234 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | [(E,2R)-2-(methoxymethoxy)-2-methyl-5-phenylmethoxypent-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | COCO[C@](C)(/C=C/COCc1ccccc1)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H42O4Si/c1-20(2)29(21(3)4,22(5)6)28-18-24(7,27-19-25-8)15-12-16-26-17-23-13-10-9-11-14-23/h9-15,20-22H,16-19H2,1-8H3/b15-12+/t24-/m1/s1 |
| InChIKey | MDNBUPLAFXLMNT-AIIPKAINSA-N |
| XLogP | 6.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|