C25H27NO6 — CID 11362624
(1S,2S,4R,7R,9R,10R,15R)-15-methyl-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecan-12-one (PubChem CID 11362624) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is (1S,2S,4R,7R,9R,10R,15R)-15-methyl-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecan-12-one.
| Compound Name | (1S,2S,4R,7R,9R,10R,15R)-15-methyl-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecan-12-one |
|---|---|
| PubChem CID | 11362624 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (1S,2S,4R,7R,9R,10R,15R)-15-methyl-4-phenyl-9-phenylmethoxy-3,5,8,16-tetraoxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadecan-12-one |
| SMILES | C[C@@]12CCC(=O)N1[C@H]1[C@H](OCc3ccccc3)O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H]1O2 |
| InChI | InChI=1S/C25H27NO6/c1-25-13-12-19(27)26(25)20-22(32-25)21-18(15-29-23(31-21)17-10-6-3-7-11-17)30-24(20)28-14-16-8-4-2-5-9-16/h2-11,18,20-24H,12-15H2,1H3/t18-,20-,21-,22+,23-,24-,25-/m1/s1 |
| InChIKey | RLLFICUTSAWFGM-OAOCPRPWSA-N |
| XLogP | 3.15 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |