C23H23NO6 — CID 135037124
[(2S,3R)-3-phenyloxiran-2-yl]-(12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl)methanone (PubChem CID 135037124) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [(2S,3R)-3-phenyloxiran-2-yl]-(12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl)methanone.
| Compound Name | [(2S,3R)-3-phenyloxiran-2-yl]-(12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl)methanone |
|---|---|
| PubChem CID | 135037124 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [(2S,3R)-3-phenyloxiran-2-yl]-(12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-5-yl)methanone |
| SMILES | O=C([C@H]1O[C@@H]1c1ccccc1)N1COC2C3OC(c4ccccc4)OCC3OCC21 |
| InChI | InChI=1S/C23H23NO6/c25-22(21-18(29-21)14-7-3-1-4-8-14)24-13-28-19-16(24)11-26-17-12-27-23(30-20(17)19)15-9-5-2-6-10-15/h1-10,16-21,23H,11-13H2/t16?,17?,18-,19?,20?,21+,23?/m1/s1 |
| InChIKey | DPWRDYYHFXOAKI-MFRJUGMYSA-N |
| XLogP | 2.19 |
| TPSA | 69.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|