C30H28N2O6S2 — CID 11365205
N,N'-bis[(2-methoxyphenyl)-(4-methylphenyl)-oxo-λ6-sulfanylidene]oxamide (PubChem CID 11365205) has the molecular formula C30H28N2O6S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is N,N'-bis[(2-methoxyphenyl)-(4-methylphenyl)-oxo-λ6-sulfanylidene]oxamide.
| Compound Name | N,N'-bis[(2-methoxyphenyl)-(4-methylphenyl)-oxo-λ6-sulfanylidene]oxamide |
|---|---|
| PubChem CID | 11365205 |
| Molecular Formula | C30H28N2O6S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | N,N'-bis[(2-methoxyphenyl)-(4-methylphenyl)-oxo-λ6-sulfanylidene]oxamide |
| SMILES | COc1ccccc1S(=O)(=NC(=O)C(=O)N=S(=O)(c1ccc(C)cc1)c1ccccc1OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28N2O6S2/c1-21-13-17-23(18-14-21)39(35,27-11-7-5-9-25(27)37-3)31-29(33)30(34)32-40(36,24-19-15-22(2)16-20-24)28-12-8-6-10-26(28)38-4/h5-20H,1-4H3 |
| InChIKey | JJKFQPGOTDJTBR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|