C14H17NOSe — CID 11369879
8-methyl-5-(3-methylphenyl)-4-selena-6-azaspiro[2.5]oct-5-en-7-ol (PubChem CID 11369879) has the molecular formula C14H17NOSe and a molecular weight of 294.26 g/mol. Its IUPAC name is 8-methyl-5-(3-methylphenyl)-4-selena-6-azaspiro[2.5]oct-5-en-7-ol.
| Compound Name | 8-methyl-5-(3-methylphenyl)-4-selena-6-azaspiro[2.5]oct-5-en-7-ol |
|---|---|
| PubChem CID | 11369879 |
| Molecular Formula | C14H17NOSe |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 8-methyl-5-(3-methylphenyl)-4-selena-6-azaspiro[2.5]oct-5-en-7-ol |
| SMILES | Cc1cccc(C2=NC(O)C(C)C3(CC3)[Se]2)c1 |
| InChI | InChI=1S/C14H17NOSe/c1-9-4-3-5-11(8-9)13-15-12(16)10(2)14(17-13)6-7-14/h3-5,8,10,12,16H,6-7H2,1-2H3 |
| InChIKey | HJXSIRYZSAHRIM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|