C13H23O7P — CID 11370680
[(3R,5R,6Z,8Z,10E)-2,5,12-trihydroxy-2-methyldodeca-6,8,10-trien-3-yl] dihydrogen phosphate (PubChem CID 11370680) has the molecular formula C13H23O7P and a molecular weight of 322.29 g/mol. Its IUPAC name is [(3R,5R,6Z,8Z,10E)-2,5,12-trihydroxy-2-methyldodeca-6,8,10-trien-3-yl] dihydrogen phosphate.
| Compound Name | [(3R,5R,6Z,8Z,10E)-2,5,12-trihydroxy-2-methyldodeca-6,8,10-trien-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11370680 |
| Molecular Formula | C13H23O7P |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(3R,5R,6Z,8Z,10E)-2,5,12-trihydroxy-2-methyldodeca-6,8,10-trien-3-yl] dihydrogen phosphate |
| SMILES | CC(C)(O)[C@@H](C[C@@H](O)/C=C\C=C/C=C/CO)OP(=O)(O)O |
| InChI | InChI=1S/C13H23O7P/c1-13(2,16)12(20-21(17,18)19)10-11(15)8-6-4-3-5-7-9-14/h3-8,11-12,14-16H,9-10H2,1-2H3,(H2,17,18,19)/b4-3-,7-5+,8-6-/t11-,12+/m0/s1 |
| InChIKey | NKDHKEKWEPUSGV-FSRKWKIZSA-N |
| XLogP | 0.65 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|