C17H11F3N2O3 — CID 11371458
4-[3-[2-(trifluoromethoxy)phenyl]phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 11371458) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is 4-[3-[2-(trifluoromethoxy)phenyl]phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | 4-[3-[2-(trifluoromethoxy)phenyl]phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 11371458 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[3-[2-(trifluoromethoxy)phenyl]phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(-c3ccccc3OC(F)(F)F)c2)co1 |
| InChI | InChI=1S/C17H11F3N2O3/c18-17(19,20)25-14-7-2-1-6-12(14)10-4-3-5-11(8-10)13-9-24-16(22-13)15(21)23/h1-9H,(H2,21,23) |
| InChIKey | VXBZBOIYYYVXOK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |