C18H13F3N4O2 — CID 11360822
4-amino-6-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide (PubChem CID 11360822) has the molecular formula C18H13F3N4O2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-amino-6-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide.
| Compound Name | 4-amino-6-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 11360822 |
| Molecular Formula | C18H13F3N4O2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-amino-6-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1nc(N)cc(-c2cccc(-c3ccccc3OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H13F3N4O2/c19-18(20,21)27-14-7-2-1-6-12(14)10-4-3-5-11(8-10)13-9-15(22)25-17(24-13)16(23)26/h1-9H,(H2,23,26)(H2,22,24,25) |
| InChIKey | ZTLNSZASFAXSTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |