C17H11F3N4O2 — CID 58774782
4-[6-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]pyrimidine-2-carboxamide (PubChem CID 58774782) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 4-[6-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]pyrimidine-2-carboxamide.
| Compound Name | 4-[6-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 58774782 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[6-[2-(trifluoromethoxy)phenyl]-2-pyridinyl]pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1nccc(-c2cccc(-c3ccccc3OC(F)(F)F)n2)n1 |
| InChI | InChI=1S/C17H11F3N4O2/c18-17(19,20)26-14-7-2-1-4-10(14)11-5-3-6-12(23-11)13-8-9-22-16(24-13)15(21)25/h1-9H,(H2,21,25) |
| InChIKey | ZAPNPEUBJDSOSL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |