C20H15F3N4O3 — CID 11258549
N-(2-amino-2-oxoethyl)-4-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide (PubChem CID 11258549) has the molecular formula C20H15F3N4O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 11258549 |
| Molecular Formula | C20H15F3N4O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyrimidine-2-carboxamide |
| SMILES | NC(=O)CNC(=O)c1nccc(-c2cccc(-c3ccccc3OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H15F3N4O3/c21-20(22,23)30-16-7-2-1-6-14(16)12-4-3-5-13(10-12)15-8-9-25-18(27-15)19(29)26-11-17(24)28/h1-10H,11H2,(H2,24,28)(H,26,29) |
| InChIKey | AZBNUUCMODCSIP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |