C23H30N2O6 — CID 11373791
tert-butyl 2-[(3R,5S,10S)-3-formyl-7-[(4-methoxyphenyl)methyl]-1,6-dioxo-2,7-diazaspiro[4.5]decan-10-yl]acetate (PubChem CID 11373791) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is tert-butyl 2-[(3R,5S,10S)-3-formyl-7-[(4-methoxyphenyl)methyl]-1,6-dioxo-2,7-diazaspiro[4.5]decan-10-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,5S,10S)-3-formyl-7-[(4-methoxyphenyl)methyl]-1,6-dioxo-2,7-diazaspiro[4.5]decan-10-yl]acetate |
|---|---|
| PubChem CID | 11373791 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | tert-butyl 2-[(3R,5S,10S)-3-formyl-7-[(4-methoxyphenyl)methyl]-1,6-dioxo-2,7-diazaspiro[4.5]decan-10-yl]acetate |
| SMILES | COc1ccc(CN2CC[C@@H](CC(=O)OC(C)(C)C)[C@]3(C[C@H](C=O)NC3=O)C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O6/c1-22(2,3)31-19(27)11-16-9-10-25(13-15-5-7-18(30-4)8-6-15)21(29)23(16)12-17(14-26)24-20(23)28/h5-8,14,16-17H,9-13H2,1-4H3,(H,24,28)/t16-,17+,23-/m0/s1 |
| InChIKey | KPZNXKBQMMOBJY-MFEFFIJZSA-N |
| XLogP | 1.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|