C31H22Cl2F2N2O5 — CID 11376999
[2-[1-[bis(4-chlorophenyl)methyl]azetidin-3-ylidene]-2-(3,5-difluorophenyl)ethyl] (4-nitrophenyl) carbonate (PubChem CID 11376999) has the molecular formula C31H22Cl2F2N2O5 and a molecular weight of 611.43 g/mol. Its IUPAC name is [2-[1-[bis(4-chlorophenyl)methyl]azetidin-3-ylidene]-2-(3,5-difluorophenyl)ethyl] (4-nitrophenyl) carbonate.
| Compound Name | [2-[1-[bis(4-chlorophenyl)methyl]azetidin-3-ylidene]-2-(3,5-difluorophenyl)ethyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 11376999 |
| Molecular Formula | C31H22Cl2F2N2O5 |
| Molecular Weight | 611.43 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | [2-[1-[bis(4-chlorophenyl)methyl]azetidin-3-ylidene]-2-(3,5-difluorophenyl)ethyl] (4-nitrophenyl) carbonate |
| SMILES | O=C(OCC(=C1CN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)C1)c1cc(F)cc(F)c1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H22Cl2F2N2O5/c32-23-5-1-19(2-6-23)30(20-3-7-24(33)8-4-20)36-16-22(17-36)29(21-13-25(34)15-26(35)14-21)18-41-31(38)42-28-11-9-27(10-12-28)37(39)40/h1-15,30H,16-18H2 |
| InChIKey | LTTVSJQZENMTLY-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.43 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|