C16H14F2N2O7S — CID 141028051
[(2R)-2-[(2,5-difluorophenyl)sulfonylamino]propyl] (4-nitrophenyl) carbonate (PubChem CID 141028051) has the molecular formula C16H14F2N2O7S and a molecular weight of 416.36 g/mol. Its IUPAC name is [(2R)-2-[(2,5-difluorophenyl)sulfonylamino]propyl] (4-nitrophenyl) carbonate.
| Compound Name | [(2R)-2-[(2,5-difluorophenyl)sulfonylamino]propyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 141028051 |
| Molecular Formula | C16H14F2N2O7S |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [(2R)-2-[(2,5-difluorophenyl)sulfonylamino]propyl] (4-nitrophenyl) carbonate |
| SMILES | C[C@H](COC(=O)Oc1ccc([N+](=O)[O-])cc1)NS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H14F2N2O7S/c1-10(19-28(24,25)15-8-11(17)2-7-14(15)18)9-26-16(21)27-13-5-3-12(4-6-13)20(22)23/h2-8,10,19H,9H2,1H3/t10-/m1/s1 |
| InChIKey | JHXGXUQEPGTTOS-SNVBAGLBSA-N |
| XLogP | 2.76 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|