C7H11NO3 — CID 11378639
(8R,8aS)-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 11378639) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (8R,8aS)-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (8R,8aS)-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 11378639 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (8R,8aS)-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OC[C@H]2[C@H](O)CCCN12 |
| InChI | InChI=1S/C7H11NO3/c9-6-2-1-3-8-5(6)4-11-7(8)10/h5-6,9H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | PNSPBQYQJUZLQH-NTSWFWBYSA-N |
| XLogP | -0.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |