C8H11NO6S — CID 160655162
(1R,2S,6R,7S)-7-hydroxy-4-methylidene-4-oxo-3,5,11-trioxa-4λ6-thia-9-azatricyclo[7.3.0.02,6]dodecan-10-one (PubChem CID 160655162) has the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. Its IUPAC name is (1R,2S,6R,7S)-7-hydroxy-4-methylidene-4-oxo-3,5,11-trioxa-4λ6-thia-9-azatricyclo[7.3.0.02,6]dodecan-10-one.
| Compound Name | (1R,2S,6R,7S)-7-hydroxy-4-methylidene-4-oxo-3,5,11-trioxa-4λ6-thia-9-azatricyclo[7.3.0.02,6]dodecan-10-one |
|---|---|
| PubChem CID | 160655162 |
| Molecular Formula | C8H11NO6S |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | (1R,2S,6R,7S)-7-hydroxy-4-methylidene-4-oxo-3,5,11-trioxa-4λ6-thia-9-azatricyclo[7.3.0.02,6]dodecan-10-one |
| SMILES | C=S1(=O)O[C@@H]2[C@H](O1)[C@@H](O)CN1C(=O)OC[C@H]21 |
| InChI | InChI=1S/C8H11NO6S/c1-16(12)14-6-4-3-13-8(11)9(4)2-5(10)7(6)15-16/h4-7,10H,1-3H2/t4-,5+,6+,7-,16?/m1/s1 |
| InChIKey | FMVGEBPEFISTAP-HFTUXSHUSA-N |
| XLogP | -1.49 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|